ChemNet > CAS > 262607-85-2 2-[4-(1,3-dithiolan-2-yl)phenoxy]-N'-hydroxyethanimidamidamid
262607-85-2 2-[4-(1,3-dithiolan-2-yl)phenoxy]-N'-hydroxyethanimidamidamid
| Produkt-Name |
2-[4-(1,3-dithiolan-2-yl)phenoxy]-N'-hydroxyethanimidamidamid |
| Synonyme |
2-[4-(1,3-dithiolan-2-yl)phenoxy]acetamidoxim |
| Englischer Name |
2-[4-(1,3-dithiolan-2-yl)phenoxy]-N'-hydroxyethanimidamide;2-[4-(1,3-Dithiolan-2-Yl)Phenoxy]Acetamidoxime |
| Molekulare Formel |
C11H14N2O2S2 |
| Molecular Weight |
270.3711 |
| InChI |
InChI=1/C11H14N2O2S2/c12-10(13-14)7-15-9-3-1-8(2-4-9)11-16-5-6-17-11/h1-4,11,14H,5-7H2,(H2,12,13) |
| CAS Registry Number |
262607-85-2 |
| Molecular Structure |
|
| Dichte |
1.44g/cm3 |
| Schmelzpunkt |
113℃ |
| Siedepunkt |
527.2°C at 760 mmHg |
| Brechungsindex |
1.683 |
| Flammpunkt |
272.6°C |
| Dampfdruck |
6.09E-12mmHg at 25°C |
| Gefahrensymbole |
Xi:Irritant;
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Beschreibung |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|